C14H18FNO4 — CID 43360056
4-[2-(3-fluorophenoxy)propanoyl-methylamino]butanoic acid (PubChem CID 43360056) has the molecular formula C14H18FNO4 and a molecular weight of 283.30 g/mol. Its IUPAC name is 4-[2-(3-fluorophenoxy)propanoyl-methylamino]butanoic acid.
| Compound Name | 4-[2-(3-fluorophenoxy)propanoyl-methylamino]butanoic acid |
|---|---|
| PubChem CID | 43360056 |
| Molecular Formula | C14H18FNO4 |
| Molecular Weight | 283.30 g/mol |
| Exact Mass | 283.12 |
| IUPAC Name | 4-[2-(3-fluorophenoxy)propanoyl-methylamino]butanoic acid |
| SMILES | CC(Oc1cccc(F)c1)C(=O)N(C)CCCC(=O)O |
| InChI | InChI=1S/C14H18FNO4/c1-10(20-12-6-3-5-11(15)9-12)14(19)16(2)8-4-7-13(17)18/h3,5-6,9-10H,4,7-8H2,1-2H3,(H,17,18) |
| InChIKey | CFRLYMATXDJSJR-UHFFFAOYSA-N |
| XLogP | 1.92 |
| TPSA | 66.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.30 |
| LogP ≤ 5 | 1.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |