C15H16N2O5 — CID 119174572
6-(3-nitrobenzoyl)-6-azaspiro[2.5]octane-2-carboxylic acid (PubChem CID 119174572) has the molecular formula C15H16N2O5 and a molecular weight of 304.30 g/mol. Its IUPAC name is 6-(3-nitrobenzoyl)-6-azaspiro[2.5]octane-2-carboxylic acid.
| Compound Name | 6-(3-nitrobenzoyl)-6-azaspiro[2.5]octane-2-carboxylic acid |
|---|---|
| PubChem CID | 119174572 |
| Molecular Formula | C15H16N2O5 |
| Molecular Weight | 304.30 g/mol |
| Exact Mass | 304.11 |
| IUPAC Name | 6-(3-nitrobenzoyl)-6-azaspiro[2.5]octane-2-carboxylic acid |
| SMILES | O=C(O)C1CC12CCN(C(=O)c1cccc([N+](=O)[O-])c1)CC2 |
| InChI | InChI=1S/C15H16N2O5/c18-13(10-2-1-3-11(8-10)17(21)22)16-6-4-15(5-7-16)9-12(15)14(19)20/h1-3,8,12H,4-7,9H2,(H,19,20) |
| InChIKey | CQLPSYNZFPNWSP-UHFFFAOYSA-N |
| XLogP | 1.92 |
| TPSA | 100.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.30 |
| LogP ≤ 5 | 1.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|