About 6-[2-(3,3-dimethylbutanoylamino)acetyl]-6-azaspiro[2.5]octane-2-carboxylic acid
6-[2-(3,3-dimethylbutanoylamino)acetyl]-6-azaspiro[2.5]octane-2-carboxylic acid (PubChem CID 119175390) has the molecular formula C16H26N2O4
and a molecular weight of 310.39 g/mol. Its IUPAC name is 6-[2-(3,3-dimethylbutanoylamino)acetyl]-6-azaspiro[2.5]octane-2-carboxylic acid.
Molecular Properties
| Compound Name | 6-[2-(3,3-dimethylbutanoylamino)acetyl]-6-azaspiro[2.5]octane-2-carboxylic acid |
| PubChem CID | 119175390 |
| Molecular Formula | C16H26N2O4 |
| Molecular Weight | 310.39 g/mol |
| Exact Mass | 310.19 |
| IUPAC Name | 6-[2-(3,3-dimethylbutanoylamino)acetyl]-6-azaspiro[2.5]octane-2-carboxylic acid |
| SMILES | CC(C)(C)CC(=O)NCC(=O)N1CCC2(CC1)CC2C(=O)O |
| InChI | InChI=1S/C16H26N2O4/c1-15(2,3)9-12(19)17-10-13(20)18-6-4-16(5-7-18)8-11(16)14(21)22/h11H,4-10H2,1-3H3,(H,17,19)(H,21,22) |
| InChIKey | UYTCWNNDLBMCEB-UHFFFAOYSA-N |
| XLogP | 1.25 |
| TPSA | 86.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 310.39 |
| LogP ≤ 5 | 1.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 6-[2-(3,3-dimethylbutanoylamino)acetyl]-6-azaspiro[2.5]octane-2-carboxylic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-[2-(3,3-dimethylbutanoylamino)acetyl]-6-azaspiro[2.5]octane-2-carboxylic acid?
The IUPAC name of 6-[2-(3,3-dimethylbutanoylamino)acetyl]-6-azaspiro[2.5]octane-2-carboxylic acid (CID 119175390) is 6-[2-(3,3-dimethylbutanoylamino)acetyl]-6-azaspiro[2.5]octane-2-carboxylic acid.
What is the SMILES notation for 6-[2-(3,3-dimethylbutanoylamino)acetyl]-6-azaspiro[2.5]octane-2-carboxylic acid?
The canonical SMILES for 6-[2-(3,3-dimethylbutanoylamino)acetyl]-6-azaspiro[2.5]octane-2-carboxylic acid is CC(C)(C)CC(=O)NCC(=O)N1CCC2(CC1)CC2C(=O)O.
What is the InChIKey of 6-[2-(3,3-dimethylbutanoylamino)acetyl]-6-azaspiro[2.5]octane-2-carboxylic acid?
The InChIKey is UYTCWNNDLBMCEB-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H26N2O4/c1-15(2,3)9-12(19)17-10-13(20)18-6-4-16(5-7-18)8-11(16)14(21)22/h11H,4-10H2,1-3H3,(H,17,19)(H,21,22).
What are the key properties of 6-[2-(3,3-dimethylbutanoylamino)acetyl]-6-azaspiro[2.5]octane-2-carboxylic acid?
6-[2-(3,3-dimethylbutanoylamino)acetyl]-6-azaspiro[2.5]octane-2-carboxylic acid has a molecular weight of 310.39 g/mol, XLogP of 1.25, 4 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 6-[2-(3,3-dimethylbutanoylamino)acetyl]-6-azaspiro[2.5]octane-2-carboxylic acid is sourced from PubChem (CID 119175390), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).