C22H27N3O3S — CID 11917825
(3aR,7aR)-2-[3-oxo-3-[2-(2-phenylethylimino)-1,3-thiazolidin-3-yl]propyl]-3a,4,5,6,7,7a-hexahydroisoindole-1,3-dione (PubChem CID 11917825) has the molecular formula C22H27N3O3S and a molecular weight of 413.54 g/mol. Its IUPAC name is (3aR,7aR)-2-[3-oxo-3-[2-(2-phenylethylimino)-1,3-thiazolidin-3-yl]propyl]-3a,4,5,6,7,7a-hexahydroisoindole-1,3-dione.
| Compound Name | (3aR,7aR)-2-[3-oxo-3-[2-(2-phenylethylimino)-1,3-thiazolidin-3-yl]propyl]-3a,4,5,6,7,7a-hexahydroisoindole-1,3-dione |
|---|---|
| PubChem CID | 11917825 |
| Molecular Formula | C22H27N3O3S |
| Molecular Weight | 413.54 g/mol |
| Exact Mass | 413.18 |
| IUPAC Name | (3aR,7aR)-2-[3-oxo-3-[2-(2-phenylethylimino)-1,3-thiazolidin-3-yl]propyl]-3a,4,5,6,7,7a-hexahydroisoindole-1,3-dione |
| SMILES | O=C1[C@@H]2CCCC[C@H]2C(=O)N1CCC(=O)N1CCS/C1=N\CCc1ccccc1 |
| InChI | InChI=1S/C22H27N3O3S/c26-19(11-13-25-20(27)17-8-4-5-9-18(17)21(25)28)24-14-15-29-22(24)23-12-10-16-6-2-1-3-7-16/h1-3,6-7,17-18H,4-5,8-15H2/b23-22-/t17-,18-/m1/s1 |
| InChIKey | NFKOPRDKCAUGPM-RJHSQMFMSA-N |
| XLogP | 2.73 |
| TPSA | 70.05 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.54 |
| LogP ≤ 5 | 2.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|