C19H25NO4 — CID 119178622
2-[1-[3-(3-methylbut-2-enoxy)benzoyl]piperidin-4-yl]acetic acid (PubChem CID 119178622) has the molecular formula C19H25NO4 and a molecular weight of 331.41 g/mol. Its IUPAC name is 2-[1-[3-(3-methylbut-2-enoxy)benzoyl]piperidin-4-yl]acetic acid.
| Compound Name | 2-[1-[3-(3-methylbut-2-enoxy)benzoyl]piperidin-4-yl]acetic acid |
|---|---|
| PubChem CID | 119178622 |
| Molecular Formula | C19H25NO4 |
| Molecular Weight | 331.41 g/mol |
| Exact Mass | 331.18 |
| IUPAC Name | 2-[1-[3-(3-methylbut-2-enoxy)benzoyl]piperidin-4-yl]acetic acid |
| SMILES | CC(C)=CCOc1cccc(C(=O)N2CCC(CC(=O)O)CC2)c1 |
| InChI | InChI=1S/C19H25NO4/c1-14(2)8-11-24-17-5-3-4-16(13-17)19(23)20-9-6-15(7-10-20)12-18(21)22/h3-5,8,13,15H,6-7,9-12H2,1-2H3,(H,21,22) |
| InChIKey | GRUDKHMYKKPGJR-UHFFFAOYSA-N |
| XLogP | 3.36 |
| TPSA | 66.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.41 |
| LogP ≤ 5 | 3.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|