C18H23F2NO3 — CID 124888350
[(3S)-4,4-difluoro-3-(hydroxymethyl)piperidin-1-yl]-[3-(3-methylbut-2-enoxy)phenyl]methanone (PubChem CID 124888350) has the molecular formula C18H23F2NO3 and a molecular weight of 339.38 g/mol. Its IUPAC name is [(3S)-4,4-difluoro-3-(hydroxymethyl)piperidin-1-yl]-[3-(3-methylbut-2-enoxy)phenyl]methanone.
| Compound Name | [(3S)-4,4-difluoro-3-(hydroxymethyl)piperidin-1-yl]-[3-(3-methylbut-2-enoxy)phenyl]methanone |
|---|---|
| PubChem CID | 124888350 |
| Molecular Formula | C18H23F2NO3 |
| Molecular Weight | 339.38 g/mol |
| Exact Mass | 339.16 |
| IUPAC Name | [(3S)-4,4-difluoro-3-(hydroxymethyl)piperidin-1-yl]-[3-(3-methylbut-2-enoxy)phenyl]methanone |
| SMILES | CC(C)=CCOc1cccc(C(=O)N2CCC(F)(F)[C@H](CO)C2)c1 |
| InChI | InChI=1S/C18H23F2NO3/c1-13(2)6-9-24-16-5-3-4-14(10-16)17(23)21-8-7-18(19,20)15(11-21)12-22/h3-6,10,15,22H,7-9,11-12H2,1-2H3/t15-/m0/s1 |
| InChIKey | YJBVHVPJMFKFJK-HNNXBMFYSA-N |
| XLogP | 3.12 |
| TPSA | 49.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.38 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|