C19H20N2O5 — CID 119182039
4-[[4-methyl-2-(oxolan-2-ylmethoxy)phenyl]carbamoyl]pyridine-2-carboxylic acid (PubChem CID 119182039) has the molecular formula C19H20N2O5 and a molecular weight of 356.38 g/mol. Its IUPAC name is 4-[[4-methyl-2-(oxolan-2-ylmethoxy)phenyl]carbamoyl]pyridine-2-carboxylic acid.
| Compound Name | 4-[[4-methyl-2-(oxolan-2-ylmethoxy)phenyl]carbamoyl]pyridine-2-carboxylic acid |
|---|---|
| PubChem CID | 119182039 |
| Molecular Formula | C19H20N2O5 |
| Molecular Weight | 356.38 g/mol |
| Exact Mass | 356.14 |
| IUPAC Name | 4-[[4-methyl-2-(oxolan-2-ylmethoxy)phenyl]carbamoyl]pyridine-2-carboxylic acid |
| SMILES | Cc1ccc(NC(=O)c2ccnc(C(=O)O)c2)c(OCC2CCCO2)c1 |
| InChI | InChI=1S/C19H20N2O5/c1-12-4-5-15(17(9-12)26-11-14-3-2-8-25-14)21-18(22)13-6-7-20-16(10-13)19(23)24/h4-7,9-10,14H,2-3,8,11H2,1H3,(H,21,22)(H,23,24) |
| InChIKey | MQRRHEWIMADBIH-UHFFFAOYSA-N |
| XLogP | 2.90 |
| TPSA | 97.75 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.38 |
| LogP ≤ 5 | 2.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |