C21H22N2O5 — CID 119186371
4-[3-oxo-3-[3-(3-oxo-1,4-benzoxazin-4-yl)propylamino]propyl]benzoic acid (PubChem CID 119186371) has the molecular formula C21H22N2O5 and a molecular weight of 382.42 g/mol. Its IUPAC name is 4-[3-oxo-3-[3-(3-oxo-1,4-benzoxazin-4-yl)propylamino]propyl]benzoic acid.
| Compound Name | 4-[3-oxo-3-[3-(3-oxo-1,4-benzoxazin-4-yl)propylamino]propyl]benzoic acid |
|---|---|
| PubChem CID | 119186371 |
| Molecular Formula | C21H22N2O5 |
| Molecular Weight | 382.42 g/mol |
| Exact Mass | 382.15 |
| IUPAC Name | 4-[3-oxo-3-[3-(3-oxo-1,4-benzoxazin-4-yl)propylamino]propyl]benzoic acid |
| SMILES | O=C(CCc1ccc(C(=O)O)cc1)NCCCN1C(=O)COc2ccccc21 |
| InChI | InChI=1S/C21H22N2O5/c24-19(11-8-15-6-9-16(10-7-15)21(26)27)22-12-3-13-23-17-4-1-2-5-18(17)28-14-20(23)25/h1-2,4-7,9-10H,3,8,11-14H2,(H,22,24)(H,26,27) |
| InChIKey | QTJOYZJWNAIVBQ-UHFFFAOYSA-N |
| XLogP | 2.25 |
| TPSA | 95.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.42 |
| LogP ≤ 5 | 2.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|