C17H24N2O5 — CID 119187103
3-[2-methylpropyl(pentan-3-yl)carbamoyl]-5-nitrobenzoic acid (PubChem CID 119187103) has the molecular formula C17H24N2O5 and a molecular weight of 336.39 g/mol. Its IUPAC name is 3-[2-methylpropyl(pentan-3-yl)carbamoyl]-5-nitrobenzoic acid.
| Compound Name | 3-[2-methylpropyl(pentan-3-yl)carbamoyl]-5-nitrobenzoic acid |
|---|---|
| PubChem CID | 119187103 |
| Molecular Formula | C17H24N2O5 |
| Molecular Weight | 336.39 g/mol |
| Exact Mass | 336.17 |
| IUPAC Name | 3-[2-methylpropyl(pentan-3-yl)carbamoyl]-5-nitrobenzoic acid |
| SMILES | CCC(CC)N(CC(C)C)C(=O)c1cc(C(=O)O)cc([N+](=O)[O-])c1 |
| InChI | InChI=1S/C17H24N2O5/c1-5-14(6-2)18(10-11(3)4)16(20)12-7-13(17(21)22)9-15(8-12)19(23)24/h7-9,11,14H,5-6,10H2,1-4H3,(H,21,22) |
| InChIKey | IREVOLKBMOMOKU-UHFFFAOYSA-N |
| XLogP | 3.58 |
| TPSA | 100.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.39 |
| LogP ≤ 5 | 3.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|