C16H17FN2O4 — CID 119188586
2-[(7-fluoro-2-oxo-1H-quinoline-4-carbonyl)amino]-4-methylpentanoic acid (PubChem CID 119188586) has the molecular formula C16H17FN2O4 and a molecular weight of 320.32 g/mol. Its IUPAC name is 2-[(7-fluoro-2-oxo-1H-quinoline-4-carbonyl)amino]-4-methylpentanoic acid.
| Compound Name | 2-[(7-fluoro-2-oxo-1H-quinoline-4-carbonyl)amino]-4-methylpentanoic acid |
|---|---|
| PubChem CID | 119188586 |
| Molecular Formula | C16H17FN2O4 |
| Molecular Weight | 320.32 g/mol |
| Exact Mass | 320.12 |
| IUPAC Name | 2-[(7-fluoro-2-oxo-1H-quinoline-4-carbonyl)amino]-4-methylpentanoic acid |
| SMILES | CC(C)CC(NC(=O)c1cc(=O)[nH]c2cc(F)ccc12)C(=O)O |
| InChI | InChI=1S/C16H17FN2O4/c1-8(2)5-13(16(22)23)19-15(21)11-7-14(20)18-12-6-9(17)3-4-10(11)12/h3-4,6-8,13H,5H2,1-2H3,(H,18,20)(H,19,21)(H,22,23) |
| InChIKey | OCDYXPJLSFJBOK-UHFFFAOYSA-N |
| XLogP | 1.90 |
| TPSA | 99.26 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.32 |
| LogP ≤ 5 | 1.90 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |