2-[2-methoxyethyl-(2-phenacylsulfanylacetyl)amino]acetic acid

C15H19NO5S — CID 119189540

IUPAC2-[2-methoxyethyl-(2-phenacylsulfanylacetyl)amino]acetic acid
SMILESCOCCN(CC(=O)O)C(=O)CSCC(=O)c1ccccc1
InChIInChI=1S/C15H19NO5S/c1-21-8-7-16(9-15(19)20)14(18)11-22-10-13(17)12-5-3-2-4-6-12/h2-6H,7-11H2,1H3,(H,19,20)
InChIKeyVYSJSEMYAVUMGF-UHFFFAOYSA-N
MW325.39 g/mol
LogP1.16
Rot. Bonds10

About 2-[2-methoxyethyl-(2-phenacylsulfanylacetyl)amino]acetic acid

2-[2-methoxyethyl-(2-phenacylsulfanylacetyl)amino]acetic acid (PubChem CID 119189540) has the molecular formula C15H19NO5S and a molecular weight of 325.39 g/mol. Its IUPAC name is 2-[2-methoxyethyl-(2-phenacylsulfanylacetyl)amino]acetic acid.

Molecular Properties

Compound Name2-[2-methoxyethyl-(2-phenacylsulfanylacetyl)amino]acetic acid
PubChem CID119189540
Molecular FormulaC15H19NO5S
Molecular Weight325.39 g/mol
Exact Mass325.10
IUPAC Name2-[2-methoxyethyl-(2-phenacylsulfanylacetyl)amino]acetic acid
SMILESCOCCN(CC(=O)O)C(=O)CSCC(=O)c1ccccc1
InChIInChI=1S/C15H19NO5S/c1-21-8-7-16(9-15(19)20)14(18)11-22-10-13(17)12-5-3-2-4-6-12/h2-6H,7-11H2,1H3,(H,19,20)
InChIKeyVYSJSEMYAVUMGF-UHFFFAOYSA-N
XLogP1.16
TPSA83.91 Ų
H-Bond Donors1
H-Bond Acceptors5
Rotatable Bonds10
Heavy Atoms22
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500325.39
LogP ≤ 51.16
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 105

Analyze 2-[2-methoxyethyl-(2-phenacylsulfanylacetyl)amino]acetic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 2-[2-methoxyethyl-(2-phenacylsulfanylacetyl)amino]acetic acid?
The IUPAC name of 2-[2-methoxyethyl-(2-phenacylsulfanylacetyl)amino]acetic acid (CID 119189540) is 2-[2-methoxyethyl-(2-phenacylsulfanylacetyl)amino]acetic acid.
What is the SMILES notation for 2-[2-methoxyethyl-(2-phenacylsulfanylacetyl)amino]acetic acid?
The canonical SMILES for 2-[2-methoxyethyl-(2-phenacylsulfanylacetyl)amino]acetic acid is COCCN(CC(=O)O)C(=O)CSCC(=O)c1ccccc1.
What is the InChIKey of 2-[2-methoxyethyl-(2-phenacylsulfanylacetyl)amino]acetic acid?
The InChIKey is VYSJSEMYAVUMGF-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H19NO5S/c1-21-8-7-16(9-15(19)20)14(18)11-22-10-13(17)12-5-3-2-4-6-12/h2-6H,7-11H2,1H3,(H,19,20).
What are the key properties of 2-[2-methoxyethyl-(2-phenacylsulfanylacetyl)amino]acetic acid?
2-[2-methoxyethyl-(2-phenacylsulfanylacetyl)amino]acetic acid has a molecular weight of 325.39 g/mol, XLogP of 1.16, 10 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[2-methoxyethyl-(2-phenacylsulfanylacetyl)amino]acetic acid is sourced from PubChem (CID 119189540), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).