C14H17NO4S — CID 119206349
2-[ethyl-(2-phenacylsulfanylacetyl)amino]acetic acid (PubChem CID 119206349) has the molecular formula C14H17NO4S and a molecular weight of 295.36 g/mol. Its IUPAC name is 2-[ethyl-(2-phenacylsulfanylacetyl)amino]acetic acid.
| Compound Name | 2-[ethyl-(2-phenacylsulfanylacetyl)amino]acetic acid |
|---|---|
| PubChem CID | 119206349 |
| Molecular Formula | C14H17NO4S |
| Molecular Weight | 295.36 g/mol |
| Exact Mass | 295.09 |
| IUPAC Name | 2-[ethyl-(2-phenacylsulfanylacetyl)amino]acetic acid |
| SMILES | CCN(CC(=O)O)C(=O)CSCC(=O)c1ccccc1 |
| InChI | InChI=1S/C14H17NO4S/c1-2-15(8-14(18)19)13(17)10-20-9-12(16)11-6-4-3-5-7-11/h3-7H,2,8-10H2,1H3,(H,18,19) |
| InChIKey | SDWUZHUEZCTWEV-UHFFFAOYSA-N |
| XLogP | 1.54 |
| TPSA | 74.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.36 |
| LogP ≤ 5 | 1.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |