C13H21N3O4 — CID 119189651
2-[(5-tert-butyl-1H-pyrazole-3-carbonyl)-(2-methoxyethyl)amino]acetic acid (PubChem CID 119189651) has the molecular formula C13H21N3O4 and a molecular weight of 283.33 g/mol. Its IUPAC name is 2-[(5-tert-butyl-1H-pyrazole-3-carbonyl)-(2-methoxyethyl)amino]acetic acid.
| Compound Name | 2-[(5-tert-butyl-1H-pyrazole-3-carbonyl)-(2-methoxyethyl)amino]acetic acid |
|---|---|
| PubChem CID | 119189651 |
| Molecular Formula | C13H21N3O4 |
| Molecular Weight | 283.33 g/mol |
| Exact Mass | 283.15 |
| IUPAC Name | 2-[(5-tert-butyl-1H-pyrazole-3-carbonyl)-(2-methoxyethyl)amino]acetic acid |
| SMILES | COCCN(CC(=O)O)C(=O)c1cc(C(C)(C)C)[nH]n1 |
| InChI | InChI=1S/C13H21N3O4/c1-13(2,3)10-7-9(14-15-10)12(19)16(5-6-20-4)8-11(17)18/h7H,5-6,8H2,1-4H3,(H,14,15)(H,17,18) |
| InChIKey | GOWXEWZRSJMODO-UHFFFAOYSA-N |
| XLogP | 0.88 |
| TPSA | 95.52 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.33 |
| LogP ≤ 5 | 0.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |