C15H22ClN3O3 — CID 119190217
3-[(5-chloro-2-propan-2-ylpyrimidine-4-carbonyl)-(2-methylpropyl)amino]propanoic acid (PubChem CID 119190217) has the molecular formula C15H22ClN3O3 and a molecular weight of 327.81 g/mol. Its IUPAC name is 3-[(5-chloro-2-propan-2-ylpyrimidine-4-carbonyl)-(2-methylpropyl)amino]propanoic acid.
| Compound Name | 3-[(5-chloro-2-propan-2-ylpyrimidine-4-carbonyl)-(2-methylpropyl)amino]propanoic acid |
|---|---|
| PubChem CID | 119190217 |
| Molecular Formula | C15H22ClN3O3 |
| Molecular Weight | 327.81 g/mol |
| Exact Mass | 327.13 |
| IUPAC Name | 3-[(5-chloro-2-propan-2-ylpyrimidine-4-carbonyl)-(2-methylpropyl)amino]propanoic acid |
| SMILES | CC(C)CN(CCC(=O)O)C(=O)c1nc(C(C)C)ncc1Cl |
| InChI | InChI=1S/C15H22ClN3O3/c1-9(2)8-19(6-5-12(20)21)15(22)13-11(16)7-17-14(18-13)10(3)4/h7,9-10H,5-6,8H2,1-4H3,(H,20,21) |
| InChIKey | OAUFKBGEOKSCAR-UHFFFAOYSA-N |
| XLogP | 2.83 |
| TPSA | 83.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.81 |
| LogP ≤ 5 | 2.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |