C13H19ClN4O2 — CID 62014799
5-chloro-N-[2-(dimethylamino)-2-oxoethyl]-N-methyl-2-propan-2-ylpyrimidine-4-carboxamide (PubChem CID 62014799) has the molecular formula C13H19ClN4O2 and a molecular weight of 298.77 g/mol. Its IUPAC name is 5-chloro-N-[2-(dimethylamino)-2-oxoethyl]-N-methyl-2-propan-2-ylpyrimidine-4-carboxamide.
| Compound Name | 5-chloro-N-[2-(dimethylamino)-2-oxoethyl]-N-methyl-2-propan-2-ylpyrimidine-4-carboxamide |
|---|---|
| PubChem CID | 62014799 |
| Molecular Formula | C13H19ClN4O2 |
| Molecular Weight | 298.77 g/mol |
| Exact Mass | 298.12 |
| IUPAC Name | 5-chloro-N-[2-(dimethylamino)-2-oxoethyl]-N-methyl-2-propan-2-ylpyrimidine-4-carboxamide |
| SMILES | CC(C)c1ncc(Cl)c(C(=O)N(C)CC(=O)N(C)C)n1 |
| InChI | InChI=1S/C13H19ClN4O2/c1-8(2)12-15-6-9(14)11(16-12)13(20)18(5)7-10(19)17(3)4/h6,8H,7H2,1-5H3 |
| InChIKey | CLFJQUJIFWZQOC-UHFFFAOYSA-N |
| XLogP | 1.41 |
| TPSA | 66.40 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.77 |
| LogP ≤ 5 | 1.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |