C17H20N2O5 — CID 119190371
3-[[2-(1,3-dioxoisoindol-2-yl)acetyl]-(2-methylpropyl)amino]propanoic acid (PubChem CID 119190371) has the molecular formula C17H20N2O5 and a molecular weight of 332.36 g/mol. Its IUPAC name is 3-[[2-(1,3-dioxoisoindol-2-yl)acetyl]-(2-methylpropyl)amino]propanoic acid.
| Compound Name | 3-[[2-(1,3-dioxoisoindol-2-yl)acetyl]-(2-methylpropyl)amino]propanoic acid |
|---|---|
| PubChem CID | 119190371 |
| Molecular Formula | C17H20N2O5 |
| Molecular Weight | 332.36 g/mol |
| Exact Mass | 332.14 |
| IUPAC Name | 3-[[2-(1,3-dioxoisoindol-2-yl)acetyl]-(2-methylpropyl)amino]propanoic acid |
| SMILES | CC(C)CN(CCC(=O)O)C(=O)CN1C(=O)c2ccccc2C1=O |
| InChI | InChI=1S/C17H20N2O5/c1-11(2)9-18(8-7-15(21)22)14(20)10-19-16(23)12-5-3-4-6-13(12)17(19)24/h3-6,11H,7-10H2,1-2H3,(H,21,22) |
| InChIKey | KYJQYMSHSFJIJQ-UHFFFAOYSA-N |
| XLogP | 1.24 |
| TPSA | 94.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.36 |
| LogP ≤ 5 | 1.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|