C16H20N2O3S — CID 119192247
2-[[2-[(4-cyanophenyl)methylsulfanyl]acetyl]amino]-2-methylpentanoic acid (PubChem CID 119192247) has the molecular formula C16H20N2O3S and a molecular weight of 320.41 g/mol. Its IUPAC name is 2-[[2-[(4-cyanophenyl)methylsulfanyl]acetyl]amino]-2-methylpentanoic acid.
| Compound Name | 2-[[2-[(4-cyanophenyl)methylsulfanyl]acetyl]amino]-2-methylpentanoic acid |
|---|---|
| PubChem CID | 119192247 |
| Molecular Formula | C16H20N2O3S |
| Molecular Weight | 320.41 g/mol |
| Exact Mass | 320.12 |
| IUPAC Name | 2-[[2-[(4-cyanophenyl)methylsulfanyl]acetyl]amino]-2-methylpentanoic acid |
| SMILES | CCCC(C)(NC(=O)CSCc1ccc(C#N)cc1)C(=O)O |
| InChI | InChI=1S/C16H20N2O3S/c1-3-8-16(2,15(20)21)18-14(19)11-22-10-13-6-4-12(9-17)5-7-13/h4-7H,3,8,10-11H2,1-2H3,(H,18,19)(H,20,21) |
| InChIKey | VJBPQPQKFSCZQX-UHFFFAOYSA-N |
| XLogP | 2.55 |
| TPSA | 90.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.41 |
| LogP ≤ 5 | 2.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |