C22H31NO5 — CID 11919396
[(2R)-1-[[(1S,2R,3S)-2,3-dimethylcyclohexyl]amino]-1-oxopropan-2-yl] (E)-3-(2,5-dimethoxyphenyl)prop-2-enoate (PubChem CID 11919396) has the molecular formula C22H31NO5 and a molecular weight of 389.49 g/mol. Its IUPAC name is [(2R)-1-[[(1S,2R,3S)-2,3-dimethylcyclohexyl]amino]-1-oxopropan-2-yl] (E)-3-(2,5-dimethoxyphenyl)prop-2-enoate.
| Compound Name | [(2R)-1-[[(1S,2R,3S)-2,3-dimethylcyclohexyl]amino]-1-oxopropan-2-yl] (E)-3-(2,5-dimethoxyphenyl)prop-2-enoate |
|---|---|
| PubChem CID | 11919396 |
| Molecular Formula | C22H31NO5 |
| Molecular Weight | 389.49 g/mol |
| Exact Mass | 389.22 |
| IUPAC Name | [(2R)-1-[[(1S,2R,3S)-2,3-dimethylcyclohexyl]amino]-1-oxopropan-2-yl] (E)-3-(2,5-dimethoxyphenyl)prop-2-enoate |
| SMILES | COc1ccc(OC)c(/C=C/C(=O)O[C@H](C)C(=O)N[C@H]2CCC[C@H](C)[C@H]2C)c1 |
| InChI | InChI=1S/C22H31NO5/c1-14-7-6-8-19(15(14)2)23-22(25)16(3)28-21(24)12-9-17-13-18(26-4)10-11-20(17)27-5/h9-16,19H,6-8H2,1-5H3,(H,23,25)/b12-9+/t14-,15+,16+,19-/m0/s1 |
| InChIKey | BERRDMOVHSKVCU-SYEDSHSNSA-N |
| XLogP | 3.59 |
| TPSA | 73.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.49 |
| LogP ≤ 5 | 3.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|