3-[(2,3-dimethylbenzoyl)amino]-4-propan-2-yloxybenzoic acid

C19H21NO4 — CID 119196243

IUPAC3-[(2,3-dimethylbenzoyl)amino]-4-propan-2-yloxybenzoic acid
SMILESCc1cccc(C(=O)Nc2cc(C(=O)O)ccc2OC(C)C)c1C
InChIInChI=1S/C19H21NO4/c1-11(2)24-17-9-8-14(19(22)23)10-16(17)20-18(21)15-7-5-6-12(3)13(15)4/h5-11H,1-4H3,(H,20,21)(H,22,23)
InChIKeyRFHHMONNMVLILB-UHFFFAOYSA-N
MW327.38 g/mol
LogP4.04
Rot. Bonds5

About 3-[(2,3-dimethylbenzoyl)amino]-4-propan-2-yloxybenzoic acid

3-[(2,3-dimethylbenzoyl)amino]-4-propan-2-yloxybenzoic acid (PubChem CID 119196243) has the molecular formula C19H21NO4 and a molecular weight of 327.38 g/mol. Its IUPAC name is 3-[(2,3-dimethylbenzoyl)amino]-4-propan-2-yloxybenzoic acid.

Molecular Properties

Compound Name3-[(2,3-dimethylbenzoyl)amino]-4-propan-2-yloxybenzoic acid
PubChem CID119196243
Molecular FormulaC19H21NO4
Molecular Weight327.38 g/mol
Exact Mass327.15
IUPAC Name3-[(2,3-dimethylbenzoyl)amino]-4-propan-2-yloxybenzoic acid
SMILESCc1cccc(C(=O)Nc2cc(C(=O)O)ccc2OC(C)C)c1C
InChIInChI=1S/C19H21NO4/c1-11(2)24-17-9-8-14(19(22)23)10-16(17)20-18(21)15-7-5-6-12(3)13(15)4/h5-11H,1-4H3,(H,20,21)(H,22,23)
InChIKeyRFHHMONNMVLILB-UHFFFAOYSA-N
XLogP4.04
TPSA75.63 Ų
H-Bond Donors2
H-Bond Acceptors3
Rotatable Bonds5
Heavy Atoms24
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500327.38
LogP ≤ 54.04
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 103

Analyze 3-[(2,3-dimethylbenzoyl)amino]-4-propan-2-yloxybenzoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 3-[(2,3-dimethylbenzoyl)amino]-4-propan-2-yloxybenzoic acid?
The IUPAC name of 3-[(2,3-dimethylbenzoyl)amino]-4-propan-2-yloxybenzoic acid (CID 119196243) is 3-[(2,3-dimethylbenzoyl)amino]-4-propan-2-yloxybenzoic acid.
What is the SMILES notation for 3-[(2,3-dimethylbenzoyl)amino]-4-propan-2-yloxybenzoic acid?
The canonical SMILES for 3-[(2,3-dimethylbenzoyl)amino]-4-propan-2-yloxybenzoic acid is Cc1cccc(C(=O)Nc2cc(C(=O)O)ccc2OC(C)C)c1C.
What is the InChIKey of 3-[(2,3-dimethylbenzoyl)amino]-4-propan-2-yloxybenzoic acid?
The InChIKey is RFHHMONNMVLILB-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H21NO4/c1-11(2)24-17-9-8-14(19(22)23)10-16(17)20-18(21)15-7-5-6-12(3)13(15)4/h5-11H,1-4H3,(H,20,21)(H,22,23).
What are the key properties of 3-[(2,3-dimethylbenzoyl)amino]-4-propan-2-yloxybenzoic acid?
3-[(2,3-dimethylbenzoyl)amino]-4-propan-2-yloxybenzoic acid has a molecular weight of 327.38 g/mol, XLogP of 4.04, 5 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[(2,3-dimethylbenzoyl)amino]-4-propan-2-yloxybenzoic acid is sourced from PubChem (CID 119196243), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).