C15H21NO6 — CID 119197506
2-[(3,5-dimethoxyphenyl)methyl-(2-ethoxyacetyl)amino]acetic acid (PubChem CID 119197506) has the molecular formula C15H21NO6 and a molecular weight of 311.33 g/mol. Its IUPAC name is 2-[(3,5-dimethoxyphenyl)methyl-(2-ethoxyacetyl)amino]acetic acid.
| Compound Name | 2-[(3,5-dimethoxyphenyl)methyl-(2-ethoxyacetyl)amino]acetic acid |
|---|---|
| PubChem CID | 119197506 |
| Molecular Formula | C15H21NO6 |
| Molecular Weight | 311.33 g/mol |
| Exact Mass | 311.14 |
| IUPAC Name | 2-[(3,5-dimethoxyphenyl)methyl-(2-ethoxyacetyl)amino]acetic acid |
| SMILES | CCOCC(=O)N(CC(=O)O)Cc1cc(OC)cc(OC)c1 |
| InChI | InChI=1S/C15H21NO6/c1-4-22-10-14(17)16(9-15(18)19)8-11-5-12(20-2)7-13(6-11)21-3/h5-7H,4,8-10H2,1-3H3,(H,18,19) |
| InChIKey | MIIBSWFDHUGNBX-UHFFFAOYSA-N |
| XLogP | 1.15 |
| TPSA | 85.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.33 |
| LogP ≤ 5 | 1.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |