C21H25NO5 — CID 119197642
2-[(3,5-dimethoxyphenyl)methyl-(4-phenylbutanoyl)amino]acetic acid (PubChem CID 119197642) has the molecular formula C21H25NO5 and a molecular weight of 371.43 g/mol. Its IUPAC name is 2-[(3,5-dimethoxyphenyl)methyl-(4-phenylbutanoyl)amino]acetic acid.
| Compound Name | 2-[(3,5-dimethoxyphenyl)methyl-(4-phenylbutanoyl)amino]acetic acid |
|---|---|
| PubChem CID | 119197642 |
| Molecular Formula | C21H25NO5 |
| Molecular Weight | 371.43 g/mol |
| Exact Mass | 371.17 |
| IUPAC Name | 2-[(3,5-dimethoxyphenyl)methyl-(4-phenylbutanoyl)amino]acetic acid |
| SMILES | COc1cc(CN(CC(=O)O)C(=O)CCCc2ccccc2)cc(OC)c1 |
| InChI | InChI=1S/C21H25NO5/c1-26-18-11-17(12-19(13-18)27-2)14-22(15-21(24)25)20(23)10-6-9-16-7-4-3-5-8-16/h3-5,7-8,11-13H,6,9-10,14-15H2,1-2H3,(H,24,25) |
| InChIKey | PEIPZJRZPOLLSQ-UHFFFAOYSA-N |
| XLogP | 3.14 |
| TPSA | 76.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.43 |
| LogP ≤ 5 | 3.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |