C16H19BrN2O4 — CID 119197904
2-[(1-acetylpiperidine-4-carbonyl)amino]-2-(4-bromophenyl)acetic acid (PubChem CID 119197904) has the molecular formula C16H19BrN2O4 and a molecular weight of 383.24 g/mol. Its IUPAC name is 2-[(1-acetylpiperidine-4-carbonyl)amino]-2-(4-bromophenyl)acetic acid.
| Compound Name | 2-[(1-acetylpiperidine-4-carbonyl)amino]-2-(4-bromophenyl)acetic acid |
|---|---|
| PubChem CID | 119197904 |
| Molecular Formula | C16H19BrN2O4 |
| Molecular Weight | 383.24 g/mol |
| Exact Mass | 382.05 |
| IUPAC Name | 2-[(1-acetylpiperidine-4-carbonyl)amino]-2-(4-bromophenyl)acetic acid |
| SMILES | CC(=O)N1CCC(C(=O)NC(C(=O)O)c2ccc(Br)cc2)CC1 |
| InChI | InChI=1S/C16H19BrN2O4/c1-10(20)19-8-6-12(7-9-19)15(21)18-14(16(22)23)11-2-4-13(17)5-3-11/h2-5,12,14H,6-9H2,1H3,(H,18,21)(H,22,23) |
| InChIKey | RPUOWSSFPVFMAT-UHFFFAOYSA-N |
| XLogP | 1.95 |
| TPSA | 86.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.24 |
| LogP ≤ 5 | 1.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |