C16H18N2O4 — CID 119199302
2-methyl-2-[[2-(4-oxoquinolin-1-yl)acetyl]amino]butanoic acid (PubChem CID 119199302) has the molecular formula C16H18N2O4 and a molecular weight of 302.33 g/mol. Its IUPAC name is 2-methyl-2-[[2-(4-oxoquinolin-1-yl)acetyl]amino]butanoic acid.
| Compound Name | 2-methyl-2-[[2-(4-oxoquinolin-1-yl)acetyl]amino]butanoic acid |
|---|---|
| PubChem CID | 119199302 |
| Molecular Formula | C16H18N2O4 |
| Molecular Weight | 302.33 g/mol |
| Exact Mass | 302.13 |
| IUPAC Name | 2-methyl-2-[[2-(4-oxoquinolin-1-yl)acetyl]amino]butanoic acid |
| SMILES | CCC(C)(NC(=O)Cn1ccc(=O)c2ccccc21)C(=O)O |
| InChI | InChI=1S/C16H18N2O4/c1-3-16(2,15(21)22)17-14(20)10-18-9-8-13(19)11-6-4-5-7-12(11)18/h4-9H,3,10H2,1-2H3,(H,17,20)(H,21,22) |
| InChIKey | ADPPGOGONJQEDB-UHFFFAOYSA-N |
| XLogP | 1.37 |
| TPSA | 88.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.33 |
| LogP ≤ 5 | 1.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |