C15H17NO2 — CID 62024225
1-(3,3-dimethyl-2-oxobutyl)quinolin-4-one (PubChem CID 62024225) has the molecular formula C15H17NO2 and a molecular weight of 243.31 g/mol. Its IUPAC name is 1-(3,3-dimethyl-2-oxobutyl)quinolin-4-one.
| Compound Name | 1-(3,3-dimethyl-2-oxobutyl)quinolin-4-one |
|---|---|
| PubChem CID | 62024225 |
| Molecular Formula | C15H17NO2 |
| Molecular Weight | 243.31 g/mol |
| Exact Mass | 243.13 |
| IUPAC Name | 1-(3,3-dimethyl-2-oxobutyl)quinolin-4-one |
| SMILES | CC(C)(C)C(=O)Cn1ccc(=O)c2ccccc21 |
| InChI | InChI=1S/C15H17NO2/c1-15(2,3)14(18)10-16-9-8-13(17)11-6-4-5-7-12(11)16/h4-9H,10H2,1-3H3 |
| InChIKey | CYBYAEOPXXJJJQ-UHFFFAOYSA-N |
| XLogP | 2.62 |
| TPSA | 39.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 243.31 |
| LogP ≤ 5 | 2.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |