C14H16BrNO — CID 55119966
1-(3-bromoindol-1-yl)-3,3-dimethylbutan-2-one (PubChem CID 55119966) has the molecular formula C14H16BrNO and a molecular weight of 294.19 g/mol. Its IUPAC name is 1-(3-bromoindol-1-yl)-3,3-dimethylbutan-2-one.
| Compound Name | 1-(3-bromoindol-1-yl)-3,3-dimethylbutan-2-one |
|---|---|
| PubChem CID | 55119966 |
| Molecular Formula | C14H16BrNO |
| Molecular Weight | 294.19 g/mol |
| Exact Mass | 293.04 |
| IUPAC Name | 1-(3-bromoindol-1-yl)-3,3-dimethylbutan-2-one |
| SMILES | CC(C)(C)C(=O)Cn1cc(Br)c2ccccc21 |
| InChI | InChI=1S/C14H16BrNO/c1-14(2,3)13(17)9-16-8-11(15)10-6-4-5-7-12(10)16/h4-8H,9H2,1-3H3 |
| InChIKey | BXYVKFFDTCARGU-UHFFFAOYSA-N |
| XLogP | 4.02 |
| TPSA | 22.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.19 |
| LogP ≤ 5 | 4.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |