C16H21N3O6S — CID 119200443
2-methyl-2-[methyl-[4-(3-oxopiperazin-1-yl)sulfonylbenzoyl]amino]propanoic acid (PubChem CID 119200443) has the molecular formula C16H21N3O6S and a molecular weight of 383.43 g/mol. Its IUPAC name is 2-methyl-2-[methyl-[4-(3-oxopiperazin-1-yl)sulfonylbenzoyl]amino]propanoic acid.
| Compound Name | 2-methyl-2-[methyl-[4-(3-oxopiperazin-1-yl)sulfonylbenzoyl]amino]propanoic acid |
|---|---|
| PubChem CID | 119200443 |
| Molecular Formula | C16H21N3O6S |
| Molecular Weight | 383.43 g/mol |
| Exact Mass | 383.12 |
| IUPAC Name | 2-methyl-2-[methyl-[4-(3-oxopiperazin-1-yl)sulfonylbenzoyl]amino]propanoic acid |
| SMILES | CN(C(=O)c1ccc(S(=O)(=O)N2CCNC(=O)C2)cc1)C(C)(C)C(=O)O |
| InChI | InChI=1S/C16H21N3O6S/c1-16(2,15(22)23)18(3)14(21)11-4-6-12(7-5-11)26(24,25)19-9-8-17-13(20)10-19/h4-7H,8-10H2,1-3H3,(H,17,20)(H,22,23) |
| InChIKey | KNAZFWHBYALGPN-UHFFFAOYSA-N |
| XLogP | -0.26 |
| TPSA | 124.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.43 |
| LogP ≤ 5 | -0.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |