C17H21N3O6S — CID 119202969
2-[cyclopropyl-[4-(3-oxopiperazin-1-yl)sulfonylbenzoyl]amino]propanoic acid (PubChem CID 119202969) has the molecular formula C17H21N3O6S and a molecular weight of 395.44 g/mol. Its IUPAC name is 2-[cyclopropyl-[4-(3-oxopiperazin-1-yl)sulfonylbenzoyl]amino]propanoic acid.
| Compound Name | 2-[cyclopropyl-[4-(3-oxopiperazin-1-yl)sulfonylbenzoyl]amino]propanoic acid |
|---|---|
| PubChem CID | 119202969 |
| Molecular Formula | C17H21N3O6S |
| Molecular Weight | 395.44 g/mol |
| Exact Mass | 395.12 |
| IUPAC Name | 2-[cyclopropyl-[4-(3-oxopiperazin-1-yl)sulfonylbenzoyl]amino]propanoic acid |
| SMILES | CC(C(=O)O)N(C(=O)c1ccc(S(=O)(=O)N2CCNC(=O)C2)cc1)C1CC1 |
| InChI | InChI=1S/C17H21N3O6S/c1-11(17(23)24)20(13-4-5-13)16(22)12-2-6-14(7-3-12)27(25,26)19-9-8-18-15(21)10-19/h2-3,6-7,11,13H,4-5,8-10H2,1H3,(H,18,21)(H,23,24) |
| InChIKey | IUGGOBBNAFBGDB-UHFFFAOYSA-N |
| XLogP | -0.12 |
| TPSA | 124.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.44 |
| LogP ≤ 5 | -0.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |