C20H21NO4 — CID 119201797
2-(3,4-dihydro-2H-chromene-3-carbonylamino)-2-phenylbutanoic acid (PubChem CID 119201797) has the molecular formula C20H21NO4 and a molecular weight of 339.39 g/mol. Its IUPAC name is 2-(3,4-dihydro-2H-chromene-3-carbonylamino)-2-phenylbutanoic acid.
| Compound Name | 2-(3,4-dihydro-2H-chromene-3-carbonylamino)-2-phenylbutanoic acid |
|---|---|
| PubChem CID | 119201797 |
| Molecular Formula | C20H21NO4 |
| Molecular Weight | 339.39 g/mol |
| Exact Mass | 339.15 |
| IUPAC Name | 2-(3,4-dihydro-2H-chromene-3-carbonylamino)-2-phenylbutanoic acid |
| SMILES | CCC(NC(=O)C1COc2ccccc2C1)(C(=O)O)c1ccccc1 |
| InChI | InChI=1S/C20H21NO4/c1-2-20(19(23)24,16-9-4-3-5-10-16)21-18(22)15-12-14-8-6-7-11-17(14)25-13-15/h3-11,15H,2,12-13H2,1H3,(H,21,22)(H,23,24) |
| InChIKey | GSBOHFTWWMGART-UHFFFAOYSA-N |
| XLogP | 2.74 |
| TPSA | 75.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.39 |
| LogP ≤ 5 | 2.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |