C21H23N3O3 — CID 11920305
(2R,4R)-4-[(3aR,7aS)-1,3-dioxo-3a,4,7,7a-tetrahydroisoindol-2-yl]-6-methyl-3-oxo-2-pyridin-2-ylheptanenitrile (PubChem CID 11920305) has the molecular formula C21H23N3O3 and a molecular weight of 365.43 g/mol. Its IUPAC name is (2R,4R)-4-[(3aR,7aS)-1,3-dioxo-3a,4,7,7a-tetrahydroisoindol-2-yl]-6-methyl-3-oxo-2-pyridin-2-ylheptanenitrile.
| Compound Name | (2R,4R)-4-[(3aR,7aS)-1,3-dioxo-3a,4,7,7a-tetrahydroisoindol-2-yl]-6-methyl-3-oxo-2-pyridin-2-ylheptanenitrile |
|---|---|
| PubChem CID | 11920305 |
| Molecular Formula | C21H23N3O3 |
| Molecular Weight | 365.43 g/mol |
| Exact Mass | 365.17 |
| IUPAC Name | (2R,4R)-4-[(3aR,7aS)-1,3-dioxo-3a,4,7,7a-tetrahydroisoindol-2-yl]-6-methyl-3-oxo-2-pyridin-2-ylheptanenitrile |
| SMILES | CC(C)C[C@H](C(=O)[C@@H](C#N)c1ccccn1)N1C(=O)[C@H]2CC=CC[C@H]2C1=O |
| InChI | InChI=1S/C21H23N3O3/c1-13(2)11-18(19(25)16(12-22)17-9-5-6-10-23-17)24-20(26)14-7-3-4-8-15(14)21(24)27/h3-6,9-10,13-16,18H,7-8,11H2,1-2H3/t14-,15+,16-,18+/m0/s1 |
| InChIKey | MOKBSNJGNVFRFU-UIBIWLFHSA-N |
| XLogP | 2.62 |
| TPSA | 91.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.43 |
| LogP ≤ 5 | 2.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|