C17H20ClN3O3 — CID 119204342
4-[[1-(3-chlorophenyl)-5-methylpyrazole-4-carbonyl]amino]-4-methylpentanoic acid (PubChem CID 119204342) has the molecular formula C17H20ClN3O3 and a molecular weight of 349.82 g/mol. Its IUPAC name is 4-[[1-(3-chlorophenyl)-5-methylpyrazole-4-carbonyl]amino]-4-methylpentanoic acid.
| Compound Name | 4-[[1-(3-chlorophenyl)-5-methylpyrazole-4-carbonyl]amino]-4-methylpentanoic acid |
|---|---|
| PubChem CID | 119204342 |
| Molecular Formula | C17H20ClN3O3 |
| Molecular Weight | 349.82 g/mol |
| Exact Mass | 349.12 |
| IUPAC Name | 4-[[1-(3-chlorophenyl)-5-methylpyrazole-4-carbonyl]amino]-4-methylpentanoic acid |
| SMILES | Cc1c(C(=O)NC(C)(C)CCC(=O)O)cnn1-c1cccc(Cl)c1 |
| InChI | InChI=1S/C17H20ClN3O3/c1-11-14(16(24)20-17(2,3)8-7-15(22)23)10-19-21(11)13-6-4-5-12(18)9-13/h4-6,9-10H,7-8H2,1-3H3,(H,20,24)(H,22,23) |
| InChIKey | GDDZSQNZEWZTLG-UHFFFAOYSA-N |
| XLogP | 3.21 |
| TPSA | 84.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.82 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |