C16H18ClN3O3 — CID 119199529
2-[[1-(3-chlorophenyl)-5-methylpyrazole-4-carbonyl]amino]-2-methylbutanoic acid (PubChem CID 119199529) has the molecular formula C16H18ClN3O3 and a molecular weight of 335.79 g/mol. Its IUPAC name is 2-[[1-(3-chlorophenyl)-5-methylpyrazole-4-carbonyl]amino]-2-methylbutanoic acid.
| Compound Name | 2-[[1-(3-chlorophenyl)-5-methylpyrazole-4-carbonyl]amino]-2-methylbutanoic acid |
|---|---|
| PubChem CID | 119199529 |
| Molecular Formula | C16H18ClN3O3 |
| Molecular Weight | 335.79 g/mol |
| Exact Mass | 335.10 |
| IUPAC Name | 2-[[1-(3-chlorophenyl)-5-methylpyrazole-4-carbonyl]amino]-2-methylbutanoic acid |
| SMILES | CCC(C)(NC(=O)c1cnn(-c2cccc(Cl)c2)c1C)C(=O)O |
| InChI | InChI=1S/C16H18ClN3O3/c1-4-16(3,15(22)23)19-14(21)13-9-18-20(10(13)2)12-7-5-6-11(17)8-12/h5-9H,4H2,1-3H3,(H,19,21)(H,22,23) |
| InChIKey | QMVUDINFBYKFOP-UHFFFAOYSA-N |
| XLogP | 2.82 |
| TPSA | 84.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.79 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |