C18H15ClN4OS — CID 55906603
1-(3-chlorophenyl)-N-(3-cyano-5-ethylthiophen-2-yl)-5-methylpyrazole-4-carboxamide (PubChem CID 55906603) has the molecular formula C18H15ClN4OS and a molecular weight of 370.87 g/mol. Its IUPAC name is 1-(3-chlorophenyl)-N-(3-cyano-5-ethylthiophen-2-yl)-5-methylpyrazole-4-carboxamide.
| Compound Name | 1-(3-chlorophenyl)-N-(3-cyano-5-ethylthiophen-2-yl)-5-methylpyrazole-4-carboxamide |
|---|---|
| PubChem CID | 55906603 |
| Molecular Formula | C18H15ClN4OS |
| Molecular Weight | 370.87 g/mol |
| Exact Mass | 370.07 |
| IUPAC Name | 1-(3-chlorophenyl)-N-(3-cyano-5-ethylthiophen-2-yl)-5-methylpyrazole-4-carboxamide |
| SMILES | CCc1cc(C#N)c(NC(=O)c2cnn(-c3cccc(Cl)c3)c2C)s1 |
| InChI | InChI=1S/C18H15ClN4OS/c1-3-15-7-12(9-20)18(25-15)22-17(24)16-10-21-23(11(16)2)14-6-4-5-13(19)8-14/h4-8,10H,3H2,1-2H3,(H,22,24) |
| InChIKey | BTNKQNVOUMOAQS-UHFFFAOYSA-N |
| XLogP | 4.58 |
| TPSA | 70.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.87 |
| LogP ≤ 5 | 4.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |