C18H22N4O4 — CID 119206691
1-[2-(6-acetamidohexanoylamino)phenyl]pyrazole-3-carboxylic acid (PubChem CID 119206691) has the molecular formula C18H22N4O4 and a molecular weight of 358.40 g/mol. Its IUPAC name is 1-[2-(6-acetamidohexanoylamino)phenyl]pyrazole-3-carboxylic acid.
| Compound Name | 1-[2-(6-acetamidohexanoylamino)phenyl]pyrazole-3-carboxylic acid |
|---|---|
| PubChem CID | 119206691 |
| Molecular Formula | C18H22N4O4 |
| Molecular Weight | 358.40 g/mol |
| Exact Mass | 358.16 |
| IUPAC Name | 1-[2-(6-acetamidohexanoylamino)phenyl]pyrazole-3-carboxylic acid |
| SMILES | CC(=O)NCCCCCC(=O)Nc1ccccc1-n1ccc(C(=O)O)n1 |
| InChI | InChI=1S/C18H22N4O4/c1-13(23)19-11-6-2-3-9-17(24)20-14-7-4-5-8-16(14)22-12-10-15(21-22)18(25)26/h4-5,7-8,10,12H,2-3,6,9,11H2,1H3,(H,19,23)(H,20,24)(H,25,26) |
| InChIKey | KFTWXDFNMYNTMR-UHFFFAOYSA-N |
| XLogP | 2.21 |
| TPSA | 113.32 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.40 |
| LogP ≤ 5 | 2.21 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|