C17H23ClN4O3 — CID 119779887
ethyl 1-[2-[4-(methylamino)butanoylamino]phenyl]pyrazole-3-carboxylate;hydrochloride (PubChem CID 119779887) has the molecular formula C17H23ClN4O3 and a molecular weight of 366.85 g/mol. Its IUPAC name is ethyl 1-[2-[4-(methylamino)butanoylamino]phenyl]pyrazole-3-carboxylate;hydrochloride.
| Compound Name | ethyl 1-[2-[4-(methylamino)butanoylamino]phenyl]pyrazole-3-carboxylate;hydrochloride |
|---|---|
| PubChem CID | 119779887 |
| Molecular Formula | C17H23ClN4O3 |
| Molecular Weight | 366.85 g/mol |
| Exact Mass | 366.15 |
| IUPAC Name | ethyl 1-[2-[4-(methylamino)butanoylamino]phenyl]pyrazole-3-carboxylate;hydrochloride |
| SMILES | CCOC(=O)c1ccn(-c2ccccc2NC(=O)CCCNC)n1.Cl |
| InChI | InChI=1S/C17H22N4O3.ClH/c1-3-24-17(23)14-10-12-21(20-14)15-8-5-4-7-13(15)19-16(22)9-6-11-18-2;/h4-5,7-8,10,12,18H,3,6,9,11H2,1-2H3,(H,19,22);1H |
| InChIKey | LXLXZOKRKYKDIR-UHFFFAOYSA-N |
| XLogP | 2.41 |
| TPSA | 85.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.85 |
| LogP ≤ 5 | 2.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|