C19H23N5O4 — CID 119206700
1-[2-[[1-(dimethylcarbamoyl)piperidine-4-carbonyl]amino]phenyl]pyrazole-3-carboxylic acid (PubChem CID 119206700) has the molecular formula C19H23N5O4 and a molecular weight of 385.42 g/mol. Its IUPAC name is 1-[2-[[1-(dimethylcarbamoyl)piperidine-4-carbonyl]amino]phenyl]pyrazole-3-carboxylic acid.
| Compound Name | 1-[2-[[1-(dimethylcarbamoyl)piperidine-4-carbonyl]amino]phenyl]pyrazole-3-carboxylic acid |
|---|---|
| PubChem CID | 119206700 |
| Molecular Formula | C19H23N5O4 |
| Molecular Weight | 385.42 g/mol |
| Exact Mass | 385.18 |
| IUPAC Name | 1-[2-[[1-(dimethylcarbamoyl)piperidine-4-carbonyl]amino]phenyl]pyrazole-3-carboxylic acid |
| SMILES | CN(C)C(=O)N1CCC(C(=O)Nc2ccccc2-n2ccc(C(=O)O)n2)CC1 |
| InChI | InChI=1S/C19H23N5O4/c1-22(2)19(28)23-10-7-13(8-11-23)17(25)20-14-5-3-4-6-16(14)24-12-9-15(21-24)18(26)27/h3-6,9,12-13H,7-8,10-11H2,1-2H3,(H,20,25)(H,26,27) |
| InChIKey | UUXHFNOWFOJNKN-UHFFFAOYSA-N |
| XLogP | 1.90 |
| TPSA | 107.77 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.42 |
| LogP ≤ 5 | 1.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |