C15H23ClN4O2 — CID 119422188
4-N-(2-aminophenyl)-1-N,1-N-dimethylpiperidine-1,4-dicarboxamide;hydrochloride (PubChem CID 119422188) has the molecular formula C15H23ClN4O2 and a molecular weight of 326.83 g/mol. Its IUPAC name is 4-N-(2-aminophenyl)-1-N,1-N-dimethylpiperidine-1,4-dicarboxamide;hydrochloride.
| Compound Name | 4-N-(2-aminophenyl)-1-N,1-N-dimethylpiperidine-1,4-dicarboxamide;hydrochloride |
|---|---|
| PubChem CID | 119422188 |
| Molecular Formula | C15H23ClN4O2 |
| Molecular Weight | 326.83 g/mol |
| Exact Mass | 326.15 |
| IUPAC Name | 4-N-(2-aminophenyl)-1-N,1-N-dimethylpiperidine-1,4-dicarboxamide;hydrochloride |
| SMILES | CN(C)C(=O)N1CCC(C(=O)Nc2ccccc2N)CC1.Cl |
| InChI | InChI=1S/C15H22N4O2.ClH/c1-18(2)15(21)19-9-7-11(8-10-19)14(20)17-13-6-4-3-5-12(13)16;/h3-6,11H,7-10,16H2,1-2H3,(H,17,20);1H |
| InChIKey | JEVMJWRSSUGALN-UHFFFAOYSA-N |
| XLogP | 2.02 |
| TPSA | 78.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.83 |
| LogP ≤ 5 | 2.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|