C20H21F2NO5 — CID 119207894
3-[(3,4-difluorophenyl)methyl-[3-(2-methoxyethoxy)benzoyl]amino]propanoic acid (PubChem CID 119207894) has the molecular formula C20H21F2NO5 and a molecular weight of 393.39 g/mol. Its IUPAC name is 3-[(3,4-difluorophenyl)methyl-[3-(2-methoxyethoxy)benzoyl]amino]propanoic acid.
| Compound Name | 3-[(3,4-difluorophenyl)methyl-[3-(2-methoxyethoxy)benzoyl]amino]propanoic acid |
|---|---|
| PubChem CID | 119207894 |
| Molecular Formula | C20H21F2NO5 |
| Molecular Weight | 393.39 g/mol |
| Exact Mass | 393.14 |
| IUPAC Name | 3-[(3,4-difluorophenyl)methyl-[3-(2-methoxyethoxy)benzoyl]amino]propanoic acid |
| SMILES | COCCOc1cccc(C(=O)N(CCC(=O)O)Cc2ccc(F)c(F)c2)c1 |
| InChI | InChI=1S/C20H21F2NO5/c1-27-9-10-28-16-4-2-3-15(12-16)20(26)23(8-7-19(24)25)13-14-5-6-17(21)18(22)11-14/h2-6,11-12H,7-10,13H2,1H3,(H,24,25) |
| InChIKey | VZHRASPIWPBLAR-UHFFFAOYSA-N |
| XLogP | 3.11 |
| TPSA | 76.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.39 |
| LogP ≤ 5 | 3.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|