C19H21FN2O4 — CID 119209718
3-[(7-fluoro-2-methylquinoline-3-carbonyl)-(oxolan-2-ylmethyl)amino]propanoic acid (PubChem CID 119209718) has the molecular formula C19H21FN2O4 and a molecular weight of 360.39 g/mol. Its IUPAC name is 3-[(7-fluoro-2-methylquinoline-3-carbonyl)-(oxolan-2-ylmethyl)amino]propanoic acid.
| Compound Name | 3-[(7-fluoro-2-methylquinoline-3-carbonyl)-(oxolan-2-ylmethyl)amino]propanoic acid |
|---|---|
| PubChem CID | 119209718 |
| Molecular Formula | C19H21FN2O4 |
| Molecular Weight | 360.39 g/mol |
| Exact Mass | 360.15 |
| IUPAC Name | 3-[(7-fluoro-2-methylquinoline-3-carbonyl)-(oxolan-2-ylmethyl)amino]propanoic acid |
| SMILES | Cc1nc2cc(F)ccc2cc1C(=O)N(CCC(=O)O)CC1CCCO1 |
| InChI | InChI=1S/C19H21FN2O4/c1-12-16(9-13-4-5-14(20)10-17(13)21-12)19(25)22(7-6-18(23)24)11-15-3-2-8-26-15/h4-5,9-10,15H,2-3,6-8,11H2,1H3,(H,23,24) |
| InChIKey | VQTFVHHODDPARJ-UHFFFAOYSA-N |
| XLogP | 2.78 |
| TPSA | 79.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.39 |
| LogP ≤ 5 | 2.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |