C18H19FN2O5 — CID 119209828
3-[(7-fluoro-2-oxo-1H-quinoline-4-carbonyl)-(oxolan-2-ylmethyl)amino]propanoic acid (PubChem CID 119209828) has the molecular formula C18H19FN2O5 and a molecular weight of 362.36 g/mol. Its IUPAC name is 3-[(7-fluoro-2-oxo-1H-quinoline-4-carbonyl)-(oxolan-2-ylmethyl)amino]propanoic acid.
| Compound Name | 3-[(7-fluoro-2-oxo-1H-quinoline-4-carbonyl)-(oxolan-2-ylmethyl)amino]propanoic acid |
|---|---|
| PubChem CID | 119209828 |
| Molecular Formula | C18H19FN2O5 |
| Molecular Weight | 362.36 g/mol |
| Exact Mass | 362.13 |
| IUPAC Name | 3-[(7-fluoro-2-oxo-1H-quinoline-4-carbonyl)-(oxolan-2-ylmethyl)amino]propanoic acid |
| SMILES | O=C(O)CCN(CC1CCCO1)C(=O)c1cc(=O)[nH]c2cc(F)ccc12 |
| InChI | InChI=1S/C18H19FN2O5/c19-11-3-4-13-14(9-16(22)20-15(13)8-11)18(25)21(6-5-17(23)24)10-12-2-1-7-26-12/h3-4,8-9,12H,1-2,5-7,10H2,(H,20,22)(H,23,24) |
| InChIKey | ODWFDFLYKYKHRQ-UHFFFAOYSA-N |
| XLogP | 1.76 |
| TPSA | 99.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.36 |
| LogP ≤ 5 | 1.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |