C17H19NO — CID 11921007
[(1R,2S,4R)-2-bicyclo[2.2.1]hept-5-enyl]-(3,4-dihydro-2H-quinolin-1-yl)methanone (PubChem CID 11921007) has the molecular formula C17H19NO and a molecular weight of 253.34 g/mol. Its IUPAC name is [(1R,2S,4R)-2-bicyclo[2.2.1]hept-5-enyl]-(3,4-dihydro-2H-quinolin-1-yl)methanone.
| Compound Name | [(1R,2S,4R)-2-bicyclo[2.2.1]hept-5-enyl]-(3,4-dihydro-2H-quinolin-1-yl)methanone |
|---|---|
| PubChem CID | 11921007 |
| Molecular Formula | C17H19NO |
| Molecular Weight | 253.34 g/mol |
| Exact Mass | 253.15 |
| IUPAC Name | [(1R,2S,4R)-2-bicyclo[2.2.1]hept-5-enyl]-(3,4-dihydro-2H-quinolin-1-yl)methanone |
| SMILES | O=C([C@H]1C[C@@H]2C=C[C@H]1C2)N1CCCc2ccccc21 |
| InChI | InChI=1S/C17H19NO/c19-17(15-11-12-7-8-14(15)10-12)18-9-3-5-13-4-1-2-6-16(13)18/h1-2,4,6-8,12,14-15H,3,5,9-11H2/t12-,14+,15+/m1/s1 |
| InChIKey | LVKMMZWHHZLKIW-SNPRPXQTSA-N |
| XLogP | 3.18 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 253.34 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|