C19H26N2O5 — CID 119212157
2-[[1-(2-ethoxyphenyl)-5-oxopyrrolidine-3-carbonyl]amino]-3-methylpentanoic acid (PubChem CID 119212157) has the molecular formula C19H26N2O5 and a molecular weight of 362.43 g/mol. Its IUPAC name is 2-[[1-(2-ethoxyphenyl)-5-oxopyrrolidine-3-carbonyl]amino]-3-methylpentanoic acid.
| Compound Name | 2-[[1-(2-ethoxyphenyl)-5-oxopyrrolidine-3-carbonyl]amino]-3-methylpentanoic acid |
|---|---|
| PubChem CID | 119212157 |
| Molecular Formula | C19H26N2O5 |
| Molecular Weight | 362.43 g/mol |
| Exact Mass | 362.18 |
| IUPAC Name | 2-[[1-(2-ethoxyphenyl)-5-oxopyrrolidine-3-carbonyl]amino]-3-methylpentanoic acid |
| SMILES | CCOc1ccccc1N1CC(C(=O)NC(C(=O)O)C(C)CC)CC1=O |
| InChI | InChI=1S/C19H26N2O5/c1-4-12(3)17(19(24)25)20-18(23)13-10-16(22)21(11-13)14-8-6-7-9-15(14)26-5-2/h6-9,12-13,17H,4-5,10-11H2,1-3H3,(H,20,23)(H,24,25) |
| InChIKey | ZQBVMZLYXXJUNN-UHFFFAOYSA-N |
| XLogP | 2.05 |
| TPSA | 95.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.43 |
| LogP ≤ 5 | 2.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |