C15H21N3O3 — CID 9164078
(3S)-1-(2-ethoxyphenyl)-N',N'-dimethyl-5-oxopyrrolidine-3-carbohydrazide (PubChem CID 9164078) has the molecular formula C15H21N3O3 and a molecular weight of 291.35 g/mol. Its IUPAC name is (3S)-1-(2-ethoxyphenyl)-N',N'-dimethyl-5-oxopyrrolidine-3-carbohydrazide.
| Compound Name | (3S)-1-(2-ethoxyphenyl)-N',N'-dimethyl-5-oxopyrrolidine-3-carbohydrazide |
|---|---|
| PubChem CID | 9164078 |
| Molecular Formula | C15H21N3O3 |
| Molecular Weight | 291.35 g/mol |
| Exact Mass | 291.16 |
| IUPAC Name | (3S)-1-(2-ethoxyphenyl)-N',N'-dimethyl-5-oxopyrrolidine-3-carbohydrazide |
| SMILES | CCOc1ccccc1N1C[C@@H](C(=O)NN(C)C)CC1=O |
| InChI | InChI=1S/C15H21N3O3/c1-4-21-13-8-6-5-7-12(13)18-10-11(9-14(18)19)15(20)16-17(2)3/h5-8,11H,4,9-10H2,1-3H3,(H,16,20)/t11-/m0/s1 |
| InChIKey | VNFVIRBUUXZOJD-NSHDSACASA-N |
| XLogP | 1.03 |
| TPSA | 61.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.35 |
| LogP ≤ 5 | 1.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|