C17H29NO5 — CID 119212443
3-[[2-(3-methylcyclohexyl)oxyacetyl]-(oxan-4-yl)amino]propanoic acid (PubChem CID 119212443) has the molecular formula C17H29NO5 and a molecular weight of 327.42 g/mol. Its IUPAC name is 3-[[2-(3-methylcyclohexyl)oxyacetyl]-(oxan-4-yl)amino]propanoic acid.
| Compound Name | 3-[[2-(3-methylcyclohexyl)oxyacetyl]-(oxan-4-yl)amino]propanoic acid |
|---|---|
| PubChem CID | 119212443 |
| Molecular Formula | C17H29NO5 |
| Molecular Weight | 327.42 g/mol |
| Exact Mass | 327.20 |
| IUPAC Name | 3-[[2-(3-methylcyclohexyl)oxyacetyl]-(oxan-4-yl)amino]propanoic acid |
| SMILES | CC1CCCC(OCC(=O)N(CCC(=O)O)C2CCOCC2)C1 |
| InChI | InChI=1S/C17H29NO5/c1-13-3-2-4-15(11-13)23-12-16(19)18(8-5-17(20)21)14-6-9-22-10-7-14/h13-15H,2-12H2,1H3,(H,20,21) |
| InChIKey | XVXTVIJFABLRHN-UHFFFAOYSA-N |
| XLogP | 2.06 |
| TPSA | 76.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.42 |
| LogP ≤ 5 | 2.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |