C23H42N2O4 — CID 124856388
2-[(1S,3R)-3-methylcyclohexyl]oxy-N-[4-[methyl-[2-[(1S,3R)-3-methylcyclohexyl]oxyacetyl]amino]butyl]acetamide (PubChem CID 124856388) has the molecular formula C23H42N2O4 and a molecular weight of 410.60 g/mol. Its IUPAC name is 2-[(1S,3R)-3-methylcyclohexyl]oxy-N-[4-[methyl-[2-[(1S,3R)-3-methylcyclohexyl]oxyacetyl]amino]butyl]acetamide.
| Compound Name | 2-[(1S,3R)-3-methylcyclohexyl]oxy-N-[4-[methyl-[2-[(1S,3R)-3-methylcyclohexyl]oxyacetyl]amino]butyl]acetamide |
|---|---|
| PubChem CID | 124856388 |
| Molecular Formula | C23H42N2O4 |
| Molecular Weight | 410.60 g/mol |
| Exact Mass | 410.31 |
| IUPAC Name | 2-[(1S,3R)-3-methylcyclohexyl]oxy-N-[4-[methyl-[2-[(1S,3R)-3-methylcyclohexyl]oxyacetyl]amino]butyl]acetamide |
| SMILES | C[C@@H]1CCC[C@H](OCC(=O)NCCCCN(C)C(=O)CO[C@H]2CCC[C@@H](C)C2)C1 |
| InChI | InChI=1S/C23H42N2O4/c1-18-8-6-10-20(14-18)28-16-22(26)24-12-4-5-13-25(3)23(27)17-29-21-11-7-9-19(2)15-21/h18-21H,4-17H2,1-3H3,(H,24,26)/t18-,19-,20+,21+/m1/s1 |
| InChIKey | KCTYKTUAQBKKBX-CGXNFDGLSA-N |
| XLogP | 3.53 |
| TPSA | 67.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.60 |
| LogP ≤ 5 | 3.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|