C18H20N2O6S — CID 119214192
3-[(3-acetamido-3-thiophen-2-ylpropanoyl)amino]-4,5-dimethoxybenzoic acid (PubChem CID 119214192) has the molecular formula C18H20N2O6S and a molecular weight of 392.43 g/mol. Its IUPAC name is 3-[(3-acetamido-3-thiophen-2-ylpropanoyl)amino]-4,5-dimethoxybenzoic acid.
| Compound Name | 3-[(3-acetamido-3-thiophen-2-ylpropanoyl)amino]-4,5-dimethoxybenzoic acid |
|---|---|
| PubChem CID | 119214192 |
| Molecular Formula | C18H20N2O6S |
| Molecular Weight | 392.43 g/mol |
| Exact Mass | 392.10 |
| IUPAC Name | 3-[(3-acetamido-3-thiophen-2-ylpropanoyl)amino]-4,5-dimethoxybenzoic acid |
| SMILES | COc1cc(C(=O)O)cc(NC(=O)CC(NC(C)=O)c2cccs2)c1OC |
| InChI | InChI=1S/C18H20N2O6S/c1-10(21)19-12(15-5-4-6-27-15)9-16(22)20-13-7-11(18(23)24)8-14(25-2)17(13)26-3/h4-8,12H,9H2,1-3H3,(H,19,21)(H,20,22)(H,23,24) |
| InChIKey | GGOZBGJJGMMCSF-UHFFFAOYSA-N |
| XLogP | 2.67 |
| TPSA | 113.96 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.43 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |