2-[4-[3-(1,3-thiazol-4-yl)propanoylamino]oxan-4-yl]acetic acid

C13H18N2O4S — CID 119214822

IUPAC2-[4-[3-(1,3-thiazol-4-yl)propanoylamino]oxan-4-yl]acetic acid
SMILESO=C(O)CC1(NC(=O)CCc2cscn2)CCOCC1
InChIInChI=1S/C13H18N2O4S/c16-11(2-1-10-8-20-9-14-10)15-13(7-12(17)18)3-5-19-6-4-13/h8-9H,1-7H2,(H,15,16)(H,17,18)
InChIKeyOEYUBTFGTXSVHO-UHFFFAOYSA-N
MW298.36 g/mol
LogP1.22
Rot. Bonds6

About 2-[4-[3-(1,3-thiazol-4-yl)propanoylamino]oxan-4-yl]acetic acid

2-[4-[3-(1,3-thiazol-4-yl)propanoylamino]oxan-4-yl]acetic acid (PubChem CID 119214822) has the molecular formula C13H18N2O4S and a molecular weight of 298.36 g/mol. Its IUPAC name is 2-[4-[3-(1,3-thiazol-4-yl)propanoylamino]oxan-4-yl]acetic acid.

Molecular Properties

Compound Name2-[4-[3-(1,3-thiazol-4-yl)propanoylamino]oxan-4-yl]acetic acid
PubChem CID119214822
Molecular FormulaC13H18N2O4S
Molecular Weight298.36 g/mol
Exact Mass298.10
IUPAC Name2-[4-[3-(1,3-thiazol-4-yl)propanoylamino]oxan-4-yl]acetic acid
SMILESO=C(O)CC1(NC(=O)CCc2cscn2)CCOCC1
InChIInChI=1S/C13H18N2O4S/c16-11(2-1-10-8-20-9-14-10)15-13(7-12(17)18)3-5-19-6-4-13/h8-9H,1-7H2,(H,15,16)(H,17,18)
InChIKeyOEYUBTFGTXSVHO-UHFFFAOYSA-N
XLogP1.22
TPSA88.52 Ų
H-Bond Donors2
H-Bond Acceptors5
Rotatable Bonds6
Heavy Atoms20
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500298.36
LogP ≤ 51.22
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 105

Analyze 2-[4-[3-(1,3-thiazol-4-yl)propanoylamino]oxan-4-yl]acetic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 2-[4-[3-(1,3-thiazol-4-yl)propanoylamino]oxan-4-yl]acetic acid?
The IUPAC name of 2-[4-[3-(1,3-thiazol-4-yl)propanoylamino]oxan-4-yl]acetic acid (CID 119214822) is 2-[4-[3-(1,3-thiazol-4-yl)propanoylamino]oxan-4-yl]acetic acid.
What is the SMILES notation for 2-[4-[3-(1,3-thiazol-4-yl)propanoylamino]oxan-4-yl]acetic acid?
The canonical SMILES for 2-[4-[3-(1,3-thiazol-4-yl)propanoylamino]oxan-4-yl]acetic acid is O=C(O)CC1(NC(=O)CCc2cscn2)CCOCC1.
What is the InChIKey of 2-[4-[3-(1,3-thiazol-4-yl)propanoylamino]oxan-4-yl]acetic acid?
The InChIKey is OEYUBTFGTXSVHO-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H18N2O4S/c16-11(2-1-10-8-20-9-14-10)15-13(7-12(17)18)3-5-19-6-4-13/h8-9H,1-7H2,(H,15,16)(H,17,18).
What are the key properties of 2-[4-[3-(1,3-thiazol-4-yl)propanoylamino]oxan-4-yl]acetic acid?
2-[4-[3-(1,3-thiazol-4-yl)propanoylamino]oxan-4-yl]acetic acid has a molecular weight of 298.36 g/mol, XLogP of 1.22, 6 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[4-[3-(1,3-thiazol-4-yl)propanoylamino]oxan-4-yl]acetic acid is sourced from PubChem (CID 119214822), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).