C11H14N2O3S — CID 64671214
2-[1-(1,3-thiazole-4-carbonylamino)cyclopentyl]acetic acid (PubChem CID 64671214) has the molecular formula C11H14N2O3S and a molecular weight of 254.31 g/mol. Its IUPAC name is 2-[1-(1,3-thiazole-4-carbonylamino)cyclopentyl]acetic acid.
| Compound Name | 2-[1-(1,3-thiazole-4-carbonylamino)cyclopentyl]acetic acid |
|---|---|
| PubChem CID | 64671214 |
| Molecular Formula | C11H14N2O3S |
| Molecular Weight | 254.31 g/mol |
| Exact Mass | 254.07 |
| IUPAC Name | 2-[1-(1,3-thiazole-4-carbonylamino)cyclopentyl]acetic acid |
| SMILES | O=C(O)CC1(NC(=O)c2cscn2)CCCC1 |
| InChI | InChI=1S/C11H14N2O3S/c14-9(15)5-11(3-1-2-4-11)13-10(16)8-6-17-7-12-8/h6-7H,1-5H2,(H,13,16)(H,14,15) |
| InChIKey | UZNREZSIAGYDBA-UHFFFAOYSA-N |
| XLogP | 1.66 |
| TPSA | 79.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.31 |
| LogP ≤ 5 | 1.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |