C16H16BrFN2O4 — CID 119215448
2-[4-[(6-bromo-4-fluoro-1H-indole-2-carbonyl)amino]oxan-4-yl]acetic acid (PubChem CID 119215448) has the molecular formula C16H16BrFN2O4 and a molecular weight of 399.22 g/mol. Its IUPAC name is 2-[4-[(6-bromo-4-fluoro-1H-indole-2-carbonyl)amino]oxan-4-yl]acetic acid.
| Compound Name | 2-[4-[(6-bromo-4-fluoro-1H-indole-2-carbonyl)amino]oxan-4-yl]acetic acid |
|---|---|
| PubChem CID | 119215448 |
| Molecular Formula | C16H16BrFN2O4 |
| Molecular Weight | 399.22 g/mol |
| Exact Mass | 398.03 |
| IUPAC Name | 2-[4-[(6-bromo-4-fluoro-1H-indole-2-carbonyl)amino]oxan-4-yl]acetic acid |
| SMILES | O=C(O)CC1(NC(=O)c2cc3c(F)cc(Br)cc3[nH]2)CCOCC1 |
| InChI | InChI=1S/C16H16BrFN2O4/c17-9-5-11(18)10-7-13(19-12(10)6-9)15(23)20-16(8-14(21)22)1-3-24-4-2-16/h5-7,19H,1-4,8H2,(H,20,23)(H,21,22) |
| InChIKey | BFYVXGVYTICLLQ-UHFFFAOYSA-N |
| XLogP | 2.82 |
| TPSA | 91.42 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.22 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |