2-[4-(1,3-benzodioxole-5-carbonylamino)oxan-4-yl]acetic acid

C15H17NO6 — CID 119215665

IUPAC2-[4-(1,3-benzodioxole-5-carbonylamino)oxan-4-yl]acetic acid
SMILESO=C(O)CC1(NC(=O)c2ccc3c(c2)OCO3)CCOCC1
InChIInChI=1S/C15H17NO6/c17-13(18)8-15(3-5-20-6-4-15)16-14(19)10-1-2-11-12(7-10)22-9-21-11/h1-2,7H,3-6,8-9H2,(H,16,19)(H,17,18)
InChIKeyBLXIXZTVBBKAGJ-UHFFFAOYSA-N
MW307.30 g/mol
LogP1.17
Rot. Bonds4

About 2-[4-(1,3-benzodioxole-5-carbonylamino)oxan-4-yl]acetic acid

2-[4-(1,3-benzodioxole-5-carbonylamino)oxan-4-yl]acetic acid (PubChem CID 119215665) has the molecular formula C15H17NO6 and a molecular weight of 307.30 g/mol. Its IUPAC name is 2-[4-(1,3-benzodioxole-5-carbonylamino)oxan-4-yl]acetic acid.

Molecular Properties

Compound Name2-[4-(1,3-benzodioxole-5-carbonylamino)oxan-4-yl]acetic acid
PubChem CID119215665
Molecular FormulaC15H17NO6
Molecular Weight307.30 g/mol
Exact Mass307.11
IUPAC Name2-[4-(1,3-benzodioxole-5-carbonylamino)oxan-4-yl]acetic acid
SMILESO=C(O)CC1(NC(=O)c2ccc3c(c2)OCO3)CCOCC1
InChIInChI=1S/C15H17NO6/c17-13(18)8-15(3-5-20-6-4-15)16-14(19)10-1-2-11-12(7-10)22-9-21-11/h1-2,7H,3-6,8-9H2,(H,16,19)(H,17,18)
InChIKeyBLXIXZTVBBKAGJ-UHFFFAOYSA-N
XLogP1.17
TPSA94.09 Ų
H-Bond Donors2
H-Bond Acceptors5
Rotatable Bonds4
Heavy Atoms22
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500307.30
LogP ≤ 51.17
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 105

Analyze 2-[4-(1,3-benzodioxole-5-carbonylamino)oxan-4-yl]acetic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 2-[4-(1,3-benzodioxole-5-carbonylamino)oxan-4-yl]acetic acid?
The IUPAC name of 2-[4-(1,3-benzodioxole-5-carbonylamino)oxan-4-yl]acetic acid (CID 119215665) is 2-[4-(1,3-benzodioxole-5-carbonylamino)oxan-4-yl]acetic acid.
What is the SMILES notation for 2-[4-(1,3-benzodioxole-5-carbonylamino)oxan-4-yl]acetic acid?
The canonical SMILES for 2-[4-(1,3-benzodioxole-5-carbonylamino)oxan-4-yl]acetic acid is O=C(O)CC1(NC(=O)c2ccc3c(c2)OCO3)CCOCC1.
What is the InChIKey of 2-[4-(1,3-benzodioxole-5-carbonylamino)oxan-4-yl]acetic acid?
The InChIKey is BLXIXZTVBBKAGJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H17NO6/c17-13(18)8-15(3-5-20-6-4-15)16-14(19)10-1-2-11-12(7-10)22-9-21-11/h1-2,7H,3-6,8-9H2,(H,16,19)(H,17,18).
What are the key properties of 2-[4-(1,3-benzodioxole-5-carbonylamino)oxan-4-yl]acetic acid?
2-[4-(1,3-benzodioxole-5-carbonylamino)oxan-4-yl]acetic acid has a molecular weight of 307.30 g/mol, XLogP of 1.17, 4 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[4-(1,3-benzodioxole-5-carbonylamino)oxan-4-yl]acetic acid is sourced from PubChem (CID 119215665), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).