C15H17NO6 — CID 119215665
2-[4-(1,3-benzodioxole-5-carbonylamino)oxan-4-yl]acetic acid (PubChem CID 119215665) has the molecular formula C15H17NO6 and a molecular weight of 307.30 g/mol. Its IUPAC name is 2-[4-(1,3-benzodioxole-5-carbonylamino)oxan-4-yl]acetic acid.
| Compound Name | 2-[4-(1,3-benzodioxole-5-carbonylamino)oxan-4-yl]acetic acid |
|---|---|
| PubChem CID | 119215665 |
| Molecular Formula | C15H17NO6 |
| Molecular Weight | 307.30 g/mol |
| Exact Mass | 307.11 |
| IUPAC Name | 2-[4-(1,3-benzodioxole-5-carbonylamino)oxan-4-yl]acetic acid |
| SMILES | O=C(O)CC1(NC(=O)c2ccc3c(c2)OCO3)CCOCC1 |
| InChI | InChI=1S/C15H17NO6/c17-13(18)8-15(3-5-20-6-4-15)16-14(19)10-1-2-11-12(7-10)22-9-21-11/h1-2,7H,3-6,8-9H2,(H,16,19)(H,17,18) |
| InChIKey | BLXIXZTVBBKAGJ-UHFFFAOYSA-N |
| XLogP | 1.17 |
| TPSA | 94.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.30 |
| LogP ≤ 5 | 1.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |