C12H19NO6S — CID 119216843
4-(2-cyclopentylsulfonylacetyl)morpholine-3-carboxylic acid (PubChem CID 119216843) has the molecular formula C12H19NO6S and a molecular weight of 305.35 g/mol. Its IUPAC name is 4-(2-cyclopentylsulfonylacetyl)morpholine-3-carboxylic acid.
| Compound Name | 4-(2-cyclopentylsulfonylacetyl)morpholine-3-carboxylic acid |
|---|---|
| PubChem CID | 119216843 |
| Molecular Formula | C12H19NO6S |
| Molecular Weight | 305.35 g/mol |
| Exact Mass | 305.09 |
| IUPAC Name | 4-(2-cyclopentylsulfonylacetyl)morpholine-3-carboxylic acid |
| SMILES | O=C(O)C1COCCN1C(=O)CS(=O)(=O)C1CCCC1 |
| InChI | InChI=1S/C12H19NO6S/c14-11(8-20(17,18)9-3-1-2-4-9)13-5-6-19-7-10(13)12(15)16/h9-10H,1-8H2,(H,15,16) |
| InChIKey | UHIIQLYMEGZGIW-UHFFFAOYSA-N |
| XLogP | -0.34 |
| TPSA | 100.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.35 |
| LogP ≤ 5 | -0.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |